C13H16N4O2S2 — CID 107799125
2-[(2-ethyl-1H-imidazol-5-yl)sulfonylamino]-6-methylbenzenecarbothioamide (PubChem CID 107799125) has the molecular formula C13H16N4O2S2 and a molecular weight of 324.43 g/mol. Its IUPAC name is 2-[(2-ethyl-1H-imidazol-5-yl)sulfonylamino]-6-methylbenzenecarbothioamide.
| Compound Name | 2-[(2-ethyl-1H-imidazol-5-yl)sulfonylamino]-6-methylbenzenecarbothioamide |
|---|---|
| PubChem CID | 107799125 |
| Molecular Formula | C13H16N4O2S2 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 2-[(2-ethyl-1H-imidazol-5-yl)sulfonylamino]-6-methylbenzenecarbothioamide |
| SMILES | CCc1ncc(S(=O)(=O)Nc2cccc(C)c2C(N)=S)[nH]1 |
| InChI | InChI=1S/C13H16N4O2S2/c1-3-10-15-7-11(16-10)21(18,19)17-9-6-4-5-8(2)12(9)13(14)20/h4-7,17H,3H2,1-2H3,(H2,14,20)(H,15,16) |
| InChIKey | NRJHIWJMEGJVLH-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|