C13H15N3O3S2 — CID 107799090
2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]-6-methylbenzenecarbothioamide (PubChem CID 107799090) has the molecular formula C13H15N3O3S2 and a molecular weight of 325.42 g/mol. Its IUPAC name is 2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]-6-methylbenzenecarbothioamide.
| Compound Name | 2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]-6-methylbenzenecarbothioamide |
|---|---|
| PubChem CID | 107799090 |
| Molecular Formula | C13H15N3O3S2 |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]-6-methylbenzenecarbothioamide |
| SMILES | Cc1cccc(NS(=O)(=O)c2c(C)noc2C)c1C(N)=S |
| InChI | InChI=1S/C13H15N3O3S2/c1-7-5-4-6-10(11(7)13(14)20)16-21(17,18)12-8(2)15-19-9(12)3/h4-6,16H,1-3H3,(H2,14,20) |
| InChIKey | HLNUTDRPFWIZMT-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|