C12H16F3N3O2S — CID 107806229
2-methyl-6-(4,4,4-trifluorobutylsulfonylamino)benzenecarboximidamide (PubChem CID 107806229) has the molecular formula C12H16F3N3O2S and a molecular weight of 323.34 g/mol. Its IUPAC name is 2-methyl-6-(4,4,4-trifluorobutylsulfonylamino)benzenecarboximidamide.
| Compound Name | 2-methyl-6-(4,4,4-trifluorobutylsulfonylamino)benzenecarboximidamide |
|---|---|
| PubChem CID | 107806229 |
| Molecular Formula | C12H16F3N3O2S |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 2-methyl-6-(4,4,4-trifluorobutylsulfonylamino)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1c(C)cccc1NS(=O)(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C12H16F3N3O2S/c1-8-4-2-5-9(10(8)11(16)17)18-21(19,20)7-3-6-12(13,14)15/h2,4-5,18H,3,6-7H2,1H3,(H3,16,17) |
| InChIKey | RTMLTVIEZIKINZ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 96.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|