C8H12N4O2S — CID 107806238
2-methyl-6-(sulfamoylamino)benzenecarboximidamide (PubChem CID 107806238) has the molecular formula C8H12N4O2S and a molecular weight of 228.28 g/mol. Its IUPAC name is 2-methyl-6-(sulfamoylamino)benzenecarboximidamide.
| Compound Name | 2-methyl-6-(sulfamoylamino)benzenecarboximidamide |
|---|---|
| PubChem CID | 107806238 |
| Molecular Formula | C8H12N4O2S |
| Molecular Weight | 228.28 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 2-methyl-6-(sulfamoylamino)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1c(C)cccc1NS(N)(=O)=O |
| InChI | InChI=1S/C8H12N4O2S/c1-5-3-2-4-6(7(5)8(9)10)12-15(11,13)14/h2-4,12H,1H3,(H3,9,10)(H2,11,13,14) |
| InChIKey | YYCSFWLXRAWCLH-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 122.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.28 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|