C9H12N2 — CID 5047790
2,6-dimethylbenzenecarboximidamide (PubChem CID 5047790) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is 2,6-dimethylbenzenecarboximidamide.
| Compound Name | 2,6-dimethylbenzenecarboximidamide |
|---|---|
| PubChem CID | 5047790 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 2,6-dimethylbenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1c(C)cccc1C |
| InChI | InChI=1S/C9H12N2/c1-6-4-3-5-7(2)8(6)9(10)11/h3-5H,1-2H3,(H3,10,11) |
| InChIKey | RRIKJEBDBLNLOW-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|