C15H16ClN3 — CID 62496666
2-chloro-6-(N,2-dimethylanilino)benzenecarboximidamide (PubChem CID 62496666) has the molecular formula C15H16ClN3 and a molecular weight of 273.77 g/mol. Its IUPAC name is 2-chloro-6-(N,2-dimethylanilino)benzenecarboximidamide.
| Compound Name | 2-chloro-6-(N,2-dimethylanilino)benzenecarboximidamide |
|---|---|
| PubChem CID | 62496666 |
| Molecular Formula | C15H16ClN3 |
| Molecular Weight | 273.77 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 2-chloro-6-(N,2-dimethylanilino)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1c(Cl)cccc1N(C)c1ccccc1C |
| InChI | InChI=1S/C15H16ClN3/c1-10-6-3-4-8-12(10)19(2)13-9-5-7-11(16)14(13)15(17)18/h3-9H,1-2H3,(H3,17,18) |
| InChIKey | UEMUALXIDDXJKN-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.77 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|