C19H23ClN2O — CID 25180158
2-chloro-6-(N,2-dimethylanilino)-N,N-diethylbenzamide (PubChem CID 25180158) has the molecular formula C19H23ClN2O and a molecular weight of 330.86 g/mol. Its IUPAC name is 2-chloro-6-(N,2-dimethylanilino)-N,N-diethylbenzamide.
| Compound Name | 2-chloro-6-(N,2-dimethylanilino)-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 25180158 |
| Molecular Formula | C19H23ClN2O |
| Molecular Weight | 330.86 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 2-chloro-6-(N,2-dimethylanilino)-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1c(Cl)cccc1N(C)c1ccccc1C |
| InChI | InChI=1S/C19H23ClN2O/c1-5-22(6-2)19(23)18-15(20)11-9-13-17(18)21(4)16-12-8-7-10-14(16)3/h7-13H,5-6H2,1-4H3 |
| InChIKey | MPBJGUMQPBQCSD-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.86 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |