C11H14ClNO2 — CID 68591956
3-chloro-N,N-diethyl-2-hydroxybenzamide (PubChem CID 68591956) has the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. Its IUPAC name is 3-chloro-N,N-diethyl-2-hydroxybenzamide.
| Compound Name | 3-chloro-N,N-diethyl-2-hydroxybenzamide |
|---|---|
| PubChem CID | 68591956 |
| Molecular Formula | C11H14ClNO2 |
| Molecular Weight | 227.69 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 3-chloro-N,N-diethyl-2-hydroxybenzamide |
| SMILES | CCN(CC)C(=O)c1cccc(Cl)c1O |
| InChI | InChI=1S/C11H14ClNO2/c1-3-13(4-2)11(15)8-6-5-7-9(12)10(8)14/h5-7,14H,3-4H2,1-2H3 |
| InChIKey | CCFFJSLLMWTZHY-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.69 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |