C11H15NO3 — CID 15178612
N,N-diethyl-2,3-dihydroxybenzamide (PubChem CID 15178612) has the molecular formula C11H15NO3 and a molecular weight of 209.25 g/mol. Its IUPAC name is N,N-diethyl-2,3-dihydroxybenzamide.
| Compound Name | N,N-diethyl-2,3-dihydroxybenzamide |
|---|---|
| PubChem CID | 15178612 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | N,N-diethyl-2,3-dihydroxybenzamide |
| SMILES | CCN(CC)C(=O)c1cccc(O)c1O |
| InChI | InChI=1S/C11H15NO3/c1-3-12(4-2)11(15)8-6-5-7-9(13)10(8)14/h5-7,13-14H,3-4H2,1-2H3 |
| InChIKey | KLIZIGYAPYXTBK-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|