C11H9N3O3 — CID 114343820
N,N-bis(cyanomethyl)-2,3-dihydroxybenzamide (PubChem CID 114343820) has the molecular formula C11H9N3O3 and a molecular weight of 231.21 g/mol. Its IUPAC name is N,N-bis(cyanomethyl)-2,3-dihydroxybenzamide.
| Compound Name | N,N-bis(cyanomethyl)-2,3-dihydroxybenzamide |
|---|---|
| PubChem CID | 114343820 |
| Molecular Formula | C11H9N3O3 |
| Molecular Weight | 231.21 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | N,N-bis(cyanomethyl)-2,3-dihydroxybenzamide |
| SMILES | N#CCN(CC#N)C(=O)c1cccc(O)c1O |
| InChI | InChI=1S/C11H9N3O3/c12-4-6-14(7-5-13)11(17)8-2-1-3-9(15)10(8)16/h1-3,15-16H,6-7H2 |
| InChIKey | AWTZOYJMLKRRSB-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 108.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.21 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|