C11H8IN3O — CID 615773
N,N-bis(cyanomethyl)-2-iodobenzamide (PubChem CID 615773) has the molecular formula C11H8IN3O and a molecular weight of 325.11 g/mol. Its IUPAC name is N,N-bis(cyanomethyl)-2-iodobenzamide.
| Compound Name | N,N-bis(cyanomethyl)-2-iodobenzamide |
|---|---|
| PubChem CID | 615773 |
| Molecular Formula | C11H8IN3O |
| Molecular Weight | 325.11 g/mol |
| Exact Mass | 324.97 |
| IUPAC Name | N,N-bis(cyanomethyl)-2-iodobenzamide |
| SMILES | N#CCN(CC#N)C(=O)c1ccccc1I |
| InChI | InChI=1S/C11H8IN3O/c12-10-4-2-1-3-9(10)11(16)15(7-5-13)8-6-14/h1-4H,7-8H2 |
| InChIKey | KHXRYIIJXJHDAR-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 67.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.11 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|