C13H10N4O — CID 43582545
N,N-bis(cyanomethyl)-1H-indole-4-carboxamide (PubChem CID 43582545) has the molecular formula C13H10N4O and a molecular weight of 238.25 g/mol. Its IUPAC name is N,N-bis(cyanomethyl)-1H-indole-4-carboxamide.
| Compound Name | N,N-bis(cyanomethyl)-1H-indole-4-carboxamide |
|---|---|
| PubChem CID | 43582545 |
| Molecular Formula | C13H10N4O |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | N,N-bis(cyanomethyl)-1H-indole-4-carboxamide |
| SMILES | N#CCN(CC#N)C(=O)c1cccc2[nH]ccc12 |
| InChI | InChI=1S/C13H10N4O/c14-5-8-17(9-6-15)13(18)11-2-1-3-12-10(11)4-7-16-12/h1-4,7,16H,8-9H2 |
| InChIKey | JDRIGHDKJMNDQC-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|