C14H15F3N2O — CID 60958905
N-propyl-N-(2,2,2-trifluoroethyl)-1H-indole-4-carboxamide (PubChem CID 60958905) has the molecular formula C14H15F3N2O and a molecular weight of 284.28 g/mol. Its IUPAC name is N-propyl-N-(2,2,2-trifluoroethyl)-1H-indole-4-carboxamide.
| Compound Name | N-propyl-N-(2,2,2-trifluoroethyl)-1H-indole-4-carboxamide |
|---|---|
| PubChem CID | 60958905 |
| Molecular Formula | C14H15F3N2O |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | N-propyl-N-(2,2,2-trifluoroethyl)-1H-indole-4-carboxamide |
| SMILES | CCCN(CC(F)(F)F)C(=O)c1cccc2[nH]ccc12 |
| InChI | InChI=1S/C14H15F3N2O/c1-2-8-19(9-14(15,16)17)13(20)11-4-3-5-12-10(11)6-7-18-12/h3-7,18H,2,8-9H2,1H3 |
| InChIKey | RUIMKAJHFIMGCE-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |