C14H17F4NO — CID 80719091
N-butyl-2-fluoro-3-methyl-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 80719091) has the molecular formula C14H17F4NO and a molecular weight of 291.29 g/mol. Its IUPAC name is N-butyl-2-fluoro-3-methyl-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | N-butyl-2-fluoro-3-methyl-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 80719091 |
| Molecular Formula | C14H17F4NO |
| Molecular Weight | 291.29 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | N-butyl-2-fluoro-3-methyl-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | CCCCN(CC(F)(F)F)C(=O)c1cccc(C)c1F |
| InChI | InChI=1S/C14H17F4NO/c1-3-4-8-19(9-14(16,17)18)13(20)11-7-5-6-10(2)12(11)15/h5-7H,3-4,8-9H2,1-2H3 |
| InChIKey | GCQVGHSYABTOTG-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.29 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |