C12H14ClF3N2O — CID 62235473
N-butyl-6-chloro-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide (PubChem CID 62235473) has the molecular formula C12H14ClF3N2O and a molecular weight of 294.70 g/mol. Its IUPAC name is N-butyl-6-chloro-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide.
| Compound Name | N-butyl-6-chloro-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 62235473 |
| Molecular Formula | C12H14ClF3N2O |
| Molecular Weight | 294.70 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | N-butyl-6-chloro-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide |
| SMILES | CCCCN(CC(F)(F)F)C(=O)c1cccc(Cl)n1 |
| InChI | InChI=1S/C12H14ClF3N2O/c1-2-3-7-18(8-12(14,15)16)11(19)9-5-4-6-10(13)17-9/h4-6H,2-3,7-8H2,1H3 |
| InChIKey | MQXZOBVGMXYRQZ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.70 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|