C13H17F3N2O — CID 54906063
4-amino-N-butyl-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 54906063) has the molecular formula C13H17F3N2O and a molecular weight of 274.29 g/mol. Its IUPAC name is 4-amino-N-butyl-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 4-amino-N-butyl-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 54906063 |
| Molecular Formula | C13H17F3N2O |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 4-amino-N-butyl-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | CCCCN(CC(F)(F)F)C(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C13H17F3N2O/c1-2-3-8-18(9-13(14,15)16)12(19)10-4-6-11(17)7-5-10/h4-7H,2-3,8-9,17H2,1H3 |
| InChIKey | ORWQOOKXBODCCG-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|