C13H15ClF3NO — CID 78883501
N-butyl-3-chloro-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 78883501) has the molecular formula C13H15ClF3NO and a molecular weight of 293.72 g/mol. Its IUPAC name is N-butyl-3-chloro-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | N-butyl-3-chloro-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 78883501 |
| Molecular Formula | C13H15ClF3NO |
| Molecular Weight | 293.72 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | N-butyl-3-chloro-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | CCCCN(CC(F)(F)F)C(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H15ClF3NO/c1-2-3-7-18(9-13(15,16)17)12(19)10-5-4-6-11(14)8-10/h4-6,8H,2-3,7,9H2,1H3 |
| InChIKey | HNROYCGYVTYGAE-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.72 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |