C13H18ClNO — CID 669182
3-chloro-N,N-dipropylbenzamide (PubChem CID 669182) has the molecular formula C13H18ClNO and a molecular weight of 239.75 g/mol. Its IUPAC name is 3-chloro-N,N-dipropylbenzamide.
| Compound Name | 3-chloro-N,N-dipropylbenzamide |
|---|---|
| PubChem CID | 669182 |
| Molecular Formula | C13H18ClNO |
| Molecular Weight | 239.75 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 3-chloro-N,N-dipropylbenzamide |
| SMILES | CCCN(CCC)C(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H18ClNO/c1-3-8-15(9-4-2)13(16)11-6-5-7-12(14)10-11/h5-7,10H,3-4,8-9H2,1-2H3 |
| InChIKey | MRHRRTXQAOTSRF-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.75 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |