C11H11ClF3NO2 — CID 107492196
N-(2-chloroethyl)-3-hydroxy-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 107492196) has the molecular formula C11H11ClF3NO2 and a molecular weight of 281.66 g/mol. Its IUPAC name is N-(2-chloroethyl)-3-hydroxy-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | N-(2-chloroethyl)-3-hydroxy-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 107492196 |
| Molecular Formula | C11H11ClF3NO2 |
| Molecular Weight | 281.66 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | N-(2-chloroethyl)-3-hydroxy-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | O=C(c1cccc(O)c1)N(CCCl)CC(F)(F)F |
| InChI | InChI=1S/C11H11ClF3NO2/c12-4-5-16(7-11(13,14)15)10(18)8-2-1-3-9(17)6-8/h1-3,6,17H,4-5,7H2 |
| InChIKey | IAFAHHQCIGMUMH-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.66 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|