C10H10F3NO2 — CID 60891416
3-hydroxy-N-methyl-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 60891416) has the molecular formula C10H10F3NO2 and a molecular weight of 233.19 g/mol. Its IUPAC name is 3-hydroxy-N-methyl-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 3-hydroxy-N-methyl-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 60891416 |
| Molecular Formula | C10H10F3NO2 |
| Molecular Weight | 233.19 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 3-hydroxy-N-methyl-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | CN(CC(F)(F)F)C(=O)c1cccc(O)c1 |
| InChI | InChI=1S/C10H10F3NO2/c1-14(6-10(11,12)13)9(16)7-3-2-4-8(15)5-7/h2-5,15H,6H2,1H3 |
| InChIKey | ALGWSIPBUIOXRZ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.19 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |