C10H8Br2F3NO — CID 103908249
3,5-dibromo-N-methyl-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 103908249) has the molecular formula C10H8Br2F3NO and a molecular weight of 374.98 g/mol. Its IUPAC name is 3,5-dibromo-N-methyl-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 3,5-dibromo-N-methyl-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 103908249 |
| Molecular Formula | C10H8Br2F3NO |
| Molecular Weight | 374.98 g/mol |
| Exact Mass | 372.89 |
| IUPAC Name | 3,5-dibromo-N-methyl-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | CN(CC(F)(F)F)C(=O)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C10H8Br2F3NO/c1-16(5-10(13,14)15)9(17)6-2-7(11)4-8(12)3-6/h2-4H,5H2,1H3 |
| InChIKey | JHJGWEYSKWGBRU-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.98 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |