C11H10BrF4NO — CID 78883881
3-bromo-N-ethyl-5-fluoro-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 78883881) has the molecular formula C11H10BrF4NO and a molecular weight of 328.10 g/mol. Its IUPAC name is 3-bromo-N-ethyl-5-fluoro-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 3-bromo-N-ethyl-5-fluoro-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 78883881 |
| Molecular Formula | C11H10BrF4NO |
| Molecular Weight | 328.10 g/mol |
| Exact Mass | 326.99 |
| IUPAC Name | 3-bromo-N-ethyl-5-fluoro-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | CCN(CC(F)(F)F)C(=O)c1cc(F)cc(Br)c1 |
| InChI | InChI=1S/C11H10BrF4NO/c1-2-17(6-11(14,15)16)10(18)7-3-8(12)5-9(13)4-7/h3-5H,2,6H2,1H3 |
| InChIKey | NXLGMDBLQIHHAK-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.10 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |