C14H18F3NO — CID 78858694
N-ethyl-4-propan-2-yl-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 78858694) has the molecular formula C14H18F3NO and a molecular weight of 273.30 g/mol. Its IUPAC name is N-ethyl-4-propan-2-yl-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | N-ethyl-4-propan-2-yl-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 78858694 |
| Molecular Formula | C14H18F3NO |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | N-ethyl-4-propan-2-yl-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | CCN(CC(F)(F)F)C(=O)c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C14H18F3NO/c1-4-18(9-14(15,16)17)13(19)12-7-5-11(6-8-12)10(2)3/h5-8,10H,4,9H2,1-3H3 |
| InChIKey | FTELMCZRUYKSLF-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |