C11H11BrF4N2O — CID 62814927
5-amino-2-bromo-N-ethyl-4-fluoro-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 62814927) has the molecular formula C11H11BrF4N2O and a molecular weight of 343.12 g/mol. Its IUPAC name is 5-amino-2-bromo-N-ethyl-4-fluoro-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 5-amino-2-bromo-N-ethyl-4-fluoro-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 62814927 |
| Molecular Formula | C11H11BrF4N2O |
| Molecular Weight | 343.12 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | 5-amino-2-bromo-N-ethyl-4-fluoro-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | CCN(CC(F)(F)F)C(=O)c1cc(N)c(F)cc1Br |
| InChI | InChI=1S/C11H11BrF4N2O/c1-2-18(5-11(14,15)16)10(19)6-3-9(17)8(13)4-7(6)12/h3-4H,2,5,17H2,1H3 |
| InChIKey | VCHLYHZLMQJLQM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.12 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|