C9H6BrF4NO2 — CID 62814761
2,2,2-trifluoroethyl 5-amino-2-bromo-4-fluorobenzoate (PubChem CID 62814761) has the molecular formula C9H6BrF4NO2 and a molecular weight of 316.05 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 5-amino-2-bromo-4-fluorobenzoate.
| Compound Name | 2,2,2-trifluoroethyl 5-amino-2-bromo-4-fluorobenzoate |
|---|---|
| PubChem CID | 62814761 |
| Molecular Formula | C9H6BrF4NO2 |
| Molecular Weight | 316.05 g/mol |
| Exact Mass | 314.95 |
| IUPAC Name | 2,2,2-trifluoroethyl 5-amino-2-bromo-4-fluorobenzoate |
| SMILES | Nc1cc(C(=O)OCC(F)(F)F)c(Br)cc1F |
| InChI | InChI=1S/C9H6BrF4NO2/c10-5-2-6(11)7(15)1-4(5)8(16)17-3-9(12,13)14/h1-2H,3,15H2 |
| InChIKey | IJJCUEMVVCDMRM-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.05 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|