About 1-cyanopropyl 5-amino-2-bromo-4-fluorobenzoate
1-cyanopropyl 5-amino-2-bromo-4-fluorobenzoate (PubChem CID 62816153) has the molecular formula C11H10BrFN2O2
and a molecular weight of 301.12 g/mol. Its IUPAC name is 1-cyanopropyl 5-amino-2-bromo-4-fluorobenzoate.
Molecular Properties
| Compound Name | 1-cyanopropyl 5-amino-2-bromo-4-fluorobenzoate |
| PubChem CID | 62816153 |
| Molecular Formula | C11H10BrFN2O2 |
| Molecular Weight | 301.12 g/mol |
| Exact Mass | 299.99 |
| IUPAC Name | 1-cyanopropyl 5-amino-2-bromo-4-fluorobenzoate |
| SMILES | CCC(C#N)OC(=O)c1cc(N)c(F)cc1Br |
| InChI | InChI=1S/C11H10BrFN2O2/c1-2-6(5-14)17-11(16)7-3-10(15)9(13)4-8(7)12/h3-4,6H,2,15H2,1H3 |
| InChIKey | JCPBFSCTGVOFLS-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.12 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-cyanopropyl 5-amino-2-bromo-4-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyanopropyl 5-amino-2-bromo-4-fluorobenzoate?
The IUPAC name of 1-cyanopropyl 5-amino-2-bromo-4-fluorobenzoate (CID 62816153) is 1-cyanopropyl 5-amino-2-bromo-4-fluorobenzoate.
What is the SMILES notation for 1-cyanopropyl 5-amino-2-bromo-4-fluorobenzoate?
The canonical SMILES for 1-cyanopropyl 5-amino-2-bromo-4-fluorobenzoate is CCC(C#N)OC(=O)c1cc(N)c(F)cc1Br.
What is the InChIKey of 1-cyanopropyl 5-amino-2-bromo-4-fluorobenzoate?
The InChIKey is JCPBFSCTGVOFLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10BrFN2O2/c1-2-6(5-14)17-11(16)7-3-10(15)9(13)4-8(7)12/h3-4,6H,2,15H2,1H3.
What are the key properties of 1-cyanopropyl 5-amino-2-bromo-4-fluorobenzoate?
1-cyanopropyl 5-amino-2-bromo-4-fluorobenzoate has a molecular weight of 301.12 g/mol, XLogP of 2.63, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyanopropyl 5-amino-2-bromo-4-fluorobenzoate is sourced from PubChem (CID 62816153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).