C12H13F5N2O — CID 61109258
5-amino-2,4-difluoro-N-propan-2-yl-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 61109258) has the molecular formula C12H13F5N2O and a molecular weight of 296.24 g/mol. Its IUPAC name is 5-amino-2,4-difluoro-N-propan-2-yl-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 5-amino-2,4-difluoro-N-propan-2-yl-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 61109258 |
| Molecular Formula | C12H13F5N2O |
| Molecular Weight | 296.24 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 5-amino-2,4-difluoro-N-propan-2-yl-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | CC(C)N(CC(F)(F)F)C(=O)c1cc(N)c(F)cc1F |
| InChI | InChI=1S/C12H13F5N2O/c1-6(2)19(5-12(15,16)17)11(20)7-3-10(18)9(14)4-8(7)13/h3-4,6H,5,18H2,1-2H3 |
| InChIKey | RAHDMVNQSICOFZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.24 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|