C11H11Cl2F3N2O — CID 113228638
2,6-dichloro-N-propan-2-yl-N-(2,2,2-trifluoroethyl)pyridine-3-carboxamide (PubChem CID 113228638) has the molecular formula C11H11Cl2F3N2O and a molecular weight of 315.12 g/mol. Its IUPAC name is 2,6-dichloro-N-propan-2-yl-N-(2,2,2-trifluoroethyl)pyridine-3-carboxamide.
| Compound Name | 2,6-dichloro-N-propan-2-yl-N-(2,2,2-trifluoroethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 113228638 |
| Molecular Formula | C11H11Cl2F3N2O |
| Molecular Weight | 315.12 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | 2,6-dichloro-N-propan-2-yl-N-(2,2,2-trifluoroethyl)pyridine-3-carboxamide |
| SMILES | CC(C)N(CC(F)(F)F)C(=O)c1ccc(Cl)nc1Cl |
| InChI | InChI=1S/C11H11Cl2F3N2O/c1-6(2)18(5-11(14,15)16)10(19)7-3-4-8(12)17-9(7)13/h3-4,6H,5H2,1-2H3 |
| InChIKey | HDVCQRLKHKHUOA-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.12 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|