C15H22BrFN2O — CID 62815244
5-amino-2-bromo-N,N-dibutyl-4-fluorobenzamide (PubChem CID 62815244) has the molecular formula C15H22BrFN2O and a molecular weight of 345.26 g/mol. Its IUPAC name is 5-amino-2-bromo-N,N-dibutyl-4-fluorobenzamide.
| Compound Name | 5-amino-2-bromo-N,N-dibutyl-4-fluorobenzamide |
|---|---|
| PubChem CID | 62815244 |
| Molecular Formula | C15H22BrFN2O |
| Molecular Weight | 345.26 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 5-amino-2-bromo-N,N-dibutyl-4-fluorobenzamide |
| SMILES | CCCCN(CCCC)C(=O)c1cc(N)c(F)cc1Br |
| InChI | InChI=1S/C15H22BrFN2O/c1-3-5-7-19(8-6-4-2)15(20)11-9-14(18)13(17)10-12(11)16/h9-10H,3-8,18H2,1-2H3 |
| InChIKey | LJWDGXZWQBFSJS-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.26 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|