C11H11BrFNO3 — CID 55096580
2-[(3-bromo-5-fluorobenzoyl)-methylamino]propanoic acid (PubChem CID 55096580) has the molecular formula C11H11BrFNO3 and a molecular weight of 304.12 g/mol. Its IUPAC name is 2-[(3-bromo-5-fluorobenzoyl)-methylamino]propanoic acid.
| Compound Name | 2-[(3-bromo-5-fluorobenzoyl)-methylamino]propanoic acid |
|---|---|
| PubChem CID | 55096580 |
| Molecular Formula | C11H11BrFNO3 |
| Molecular Weight | 304.12 g/mol |
| Exact Mass | 302.99 |
| IUPAC Name | 2-[(3-bromo-5-fluorobenzoyl)-methylamino]propanoic acid |
| SMILES | CC(C(=O)O)N(C)C(=O)c1cc(F)cc(Br)c1 |
| InChI | InChI=1S/C11H11BrFNO3/c1-6(11(16)17)14(2)10(15)7-3-8(12)5-9(13)4-7/h3-6H,1-2H3,(H,16,17) |
| InChIKey | BCDDJKNEVRTQTI-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.12 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |