C12H15BrN2OS — CID 113460592
N-(1-amino-1-sulfanylidenepropan-2-yl)-3-bromo-N,5-dimethylbenzamide (PubChem CID 113460592) has the molecular formula C12H15BrN2OS and a molecular weight of 315.24 g/mol. Its IUPAC name is N-(1-amino-1-sulfanylidenepropan-2-yl)-3-bromo-N,5-dimethylbenzamide.
| Compound Name | N-(1-amino-1-sulfanylidenepropan-2-yl)-3-bromo-N,5-dimethylbenzamide |
|---|---|
| PubChem CID | 113460592 |
| Molecular Formula | C12H15BrN2OS |
| Molecular Weight | 315.24 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | N-(1-amino-1-sulfanylidenepropan-2-yl)-3-bromo-N,5-dimethylbenzamide |
| SMILES | Cc1cc(Br)cc(C(=O)N(C)C(C)C(N)=S)c1 |
| InChI | InChI=1S/C12H15BrN2OS/c1-7-4-9(6-10(13)5-7)12(16)15(3)8(2)11(14)17/h4-6,8H,1-3H3,(H2,14,17) |
| InChIKey | CYLGXJIFBCCXQK-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.24 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|