C13H19BrN2O — CID 104852714
3-bromo-N-[2-(dimethylamino)ethyl]-N,5-dimethylbenzamide (PubChem CID 104852714) has the molecular formula C13H19BrN2O and a molecular weight of 299.21 g/mol. Its IUPAC name is 3-bromo-N-[2-(dimethylamino)ethyl]-N,5-dimethylbenzamide.
| Compound Name | 3-bromo-N-[2-(dimethylamino)ethyl]-N,5-dimethylbenzamide |
|---|---|
| PubChem CID | 104852714 |
| Molecular Formula | C13H19BrN2O |
| Molecular Weight | 299.21 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 3-bromo-N-[2-(dimethylamino)ethyl]-N,5-dimethylbenzamide |
| SMILES | Cc1cc(Br)cc(C(=O)N(C)CCN(C)C)c1 |
| InChI | InChI=1S/C13H19BrN2O/c1-10-7-11(9-12(14)8-10)13(17)16(4)6-5-15(2)3/h7-9H,5-6H2,1-4H3 |
| InChIKey | HCYZZZHEOIKODL-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.21 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |