C16H15BrFNO — CID 104851856
3-bromo-N-[(3-fluorophenyl)methyl]-N,5-dimethylbenzamide (PubChem CID 104851856) has the molecular formula C16H15BrFNO and a molecular weight of 336.20 g/mol. Its IUPAC name is 3-bromo-N-[(3-fluorophenyl)methyl]-N,5-dimethylbenzamide.
| Compound Name | 3-bromo-N-[(3-fluorophenyl)methyl]-N,5-dimethylbenzamide |
|---|---|
| PubChem CID | 104851856 |
| Molecular Formula | C16H15BrFNO |
| Molecular Weight | 336.20 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | 3-bromo-N-[(3-fluorophenyl)methyl]-N,5-dimethylbenzamide |
| SMILES | Cc1cc(Br)cc(C(=O)N(C)Cc2cccc(F)c2)c1 |
| InChI | InChI=1S/C16H15BrFNO/c1-11-6-13(9-14(17)7-11)16(20)19(2)10-12-4-3-5-15(18)8-12/h3-9H,10H2,1-2H3 |
| InChIKey | FKLVBGORDUMFKL-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.20 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |