C17H25NO6 — CID 119209294
2-[methyl-(3,4,5-triethoxybenzoyl)amino]propanoic acid (PubChem CID 119209294) has the molecular formula C17H25NO6 and a molecular weight of 339.39 g/mol. Its IUPAC name is 2-[methyl-(3,4,5-triethoxybenzoyl)amino]propanoic acid.
| Compound Name | 2-[methyl-(3,4,5-triethoxybenzoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 119209294 |
| Molecular Formula | C17H25NO6 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 2-[methyl-(3,4,5-triethoxybenzoyl)amino]propanoic acid |
| SMILES | CCOc1cc(C(=O)N(C)C(C)C(=O)O)cc(OCC)c1OCC |
| InChI | InChI=1S/C17H25NO6/c1-6-22-13-9-12(16(19)18(5)11(4)17(20)21)10-14(23-7-2)15(13)24-8-3/h9-11H,6-8H2,1-5H3,(H,20,21) |
| InChIKey | GQGXGCMUBJDUTN-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |