2-[methyl-(3,4,5-triethoxybenzoyl)amino]propanoic acid

C17H25NO6 — CID 119209294

IUPAC2-[methyl-(3,4,5-triethoxybenzoyl)amino]propanoic acid
SMILESCCOc1cc(C(=O)N(C)C(C)C(=O)O)cc(OCC)c1OCC
InChIInChI=1S/C17H25NO6/c1-6-22-13-9-12(16(19)18(5)11(4)17(20)21)10-14(23-7-2)15(13)24-8-3/h9-11H,6-8H2,1-5H3,(H,20,21)
InChIKeyGQGXGCMUBJDUTN-UHFFFAOYSA-N
MW339.39 g/mol
LogP2.43
Rot. Bonds9

About 2-[methyl-(3,4,5-triethoxybenzoyl)amino]propanoic acid

2-[methyl-(3,4,5-triethoxybenzoyl)amino]propanoic acid (PubChem CID 119209294) has the molecular formula C17H25NO6 and a molecular weight of 339.39 g/mol. Its IUPAC name is 2-[methyl-(3,4,5-triethoxybenzoyl)amino]propanoic acid.

Molecular Properties

Compound Name2-[methyl-(3,4,5-triethoxybenzoyl)amino]propanoic acid
PubChem CID119209294
Molecular FormulaC17H25NO6
Molecular Weight339.39 g/mol
Exact Mass339.17
IUPAC Name2-[methyl-(3,4,5-triethoxybenzoyl)amino]propanoic acid
SMILESCCOc1cc(C(=O)N(C)C(C)C(=O)O)cc(OCC)c1OCC
InChIInChI=1S/C17H25NO6/c1-6-22-13-9-12(16(19)18(5)11(4)17(20)21)10-14(23-7-2)15(13)24-8-3/h9-11H,6-8H2,1-5H3,(H,20,21)
InChIKeyGQGXGCMUBJDUTN-UHFFFAOYSA-N
XLogP2.43
TPSA85.30 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds9
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500339.39
LogP ≤ 52.43
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-[methyl-(3,4,5-triethoxybenzoyl)amino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[methyl-(3,4,5-triethoxybenzoyl)amino]propanoic acid?
The IUPAC name of 2-[methyl-(3,4,5-triethoxybenzoyl)amino]propanoic acid (CID 119209294) is 2-[methyl-(3,4,5-triethoxybenzoyl)amino]propanoic acid.
What is the SMILES notation for 2-[methyl-(3,4,5-triethoxybenzoyl)amino]propanoic acid?
The canonical SMILES for 2-[methyl-(3,4,5-triethoxybenzoyl)amino]propanoic acid is CCOc1cc(C(=O)N(C)C(C)C(=O)O)cc(OCC)c1OCC.
What is the InChIKey of 2-[methyl-(3,4,5-triethoxybenzoyl)amino]propanoic acid?
The InChIKey is GQGXGCMUBJDUTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25NO6/c1-6-22-13-9-12(16(19)18(5)11(4)17(20)21)10-14(23-7-2)15(13)24-8-3/h9-11H,6-8H2,1-5H3,(H,20,21).
What are the key properties of 2-[methyl-(3,4,5-triethoxybenzoyl)amino]propanoic acid?
2-[methyl-(3,4,5-triethoxybenzoyl)amino]propanoic acid has a molecular weight of 339.39 g/mol, XLogP of 2.43, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[methyl-(3,4,5-triethoxybenzoyl)amino]propanoic acid is sourced from PubChem (CID 119209294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).