C19H32N2O4 — CID 119653583
N-(3-amino-2,2-dimethylpropyl)-3,4,5-triethoxy-N-methylbenzamide (PubChem CID 119653583) has the molecular formula C19H32N2O4 and a molecular weight of 352.48 g/mol. Its IUPAC name is N-(3-amino-2,2-dimethylpropyl)-3,4,5-triethoxy-N-methylbenzamide.
| Compound Name | N-(3-amino-2,2-dimethylpropyl)-3,4,5-triethoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 119653583 |
| Molecular Formula | C19H32N2O4 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | N-(3-amino-2,2-dimethylpropyl)-3,4,5-triethoxy-N-methylbenzamide |
| SMILES | CCOc1cc(C(=O)N(C)CC(C)(C)CN)cc(OCC)c1OCC |
| InChI | InChI=1S/C19H32N2O4/c1-7-23-15-10-14(11-16(24-8-2)17(15)25-9-3)18(22)21(6)13-19(4,5)12-20/h10-11H,7-9,12-13,20H2,1-6H3 |
| InChIKey | HIZQDZGOGKMYQW-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |