C17H24N2O4 — CID 60593026
N-(cyanomethyl)-3,4,5-triethoxy-N-ethylbenzamide (PubChem CID 60593026) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is N-(cyanomethyl)-3,4,5-triethoxy-N-ethylbenzamide.
| Compound Name | N-(cyanomethyl)-3,4,5-triethoxy-N-ethylbenzamide |
|---|---|
| PubChem CID | 60593026 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | N-(cyanomethyl)-3,4,5-triethoxy-N-ethylbenzamide |
| SMILES | CCOc1cc(C(=O)N(CC)CC#N)cc(OCC)c1OCC |
| InChI | InChI=1S/C17H24N2O4/c1-5-19(10-9-18)17(20)13-11-14(21-6-2)16(23-8-4)15(12-13)22-7-3/h11-12H,5-8,10H2,1-4H3 |
| InChIKey | FOFFJCYQKPQIJE-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 71.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|