C23H26FNO4 — CID 52780861
3,4,5-triethoxy-N-[(4-fluorophenyl)methyl]-N-prop-2-ynylbenzamide (PubChem CID 52780861) has the molecular formula C23H26FNO4 and a molecular weight of 399.46 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-[(4-fluorophenyl)methyl]-N-prop-2-ynylbenzamide.
| Compound Name | 3,4,5-triethoxy-N-[(4-fluorophenyl)methyl]-N-prop-2-ynylbenzamide |
|---|---|
| PubChem CID | 52780861 |
| Molecular Formula | C23H26FNO4 |
| Molecular Weight | 399.46 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 3,4,5-triethoxy-N-[(4-fluorophenyl)methyl]-N-prop-2-ynylbenzamide |
| SMILES | C#CCN(Cc1ccc(F)cc1)C(=O)c1cc(OCC)c(OCC)c(OCC)c1 |
| InChI | InChI=1S/C23H26FNO4/c1-5-13-25(16-17-9-11-19(24)12-10-17)23(26)18-14-20(27-6-2)22(29-8-4)21(15-18)28-7-3/h1,9-12,14-15H,6-8,13,16H2,2-4H3 |
| InChIKey | KIKCFXAIWNITMR-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.46 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|