C24H34N2O4 — CID 55438168
N-[[4-(dimethylamino)phenyl]methyl]-3,4,5-triethoxy-N-ethylbenzamide (PubChem CID 55438168) has the molecular formula C24H34N2O4 and a molecular weight of 414.55 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-3,4,5-triethoxy-N-ethylbenzamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-3,4,5-triethoxy-N-ethylbenzamide |
|---|---|
| PubChem CID | 55438168 |
| Molecular Formula | C24H34N2O4 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-3,4,5-triethoxy-N-ethylbenzamide |
| SMILES | CCOc1cc(C(=O)N(CC)Cc2ccc(N(C)C)cc2)cc(OCC)c1OCC |
| InChI | InChI=1S/C24H34N2O4/c1-7-26(17-18-11-13-20(14-12-18)25(5)6)24(27)19-15-21(28-8-2)23(30-10-4)22(16-19)29-9-3/h11-16H,7-10,17H2,1-6H3 |
| InChIKey | LBAOHIJEJWAJOU-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|