C19H25FN2O3 — CID 52782573
tert-butyl N-[4-[(4-fluorophenyl)methyl-prop-2-ynylamino]-4-oxobutyl]carbamate (PubChem CID 52782573) has the molecular formula C19H25FN2O3 and a molecular weight of 348.42 g/mol. Its IUPAC name is tert-butyl N-[4-[(4-fluorophenyl)methyl-prop-2-ynylamino]-4-oxobutyl]carbamate.
| Compound Name | tert-butyl N-[4-[(4-fluorophenyl)methyl-prop-2-ynylamino]-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 52782573 |
| Molecular Formula | C19H25FN2O3 |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | tert-butyl N-[4-[(4-fluorophenyl)methyl-prop-2-ynylamino]-4-oxobutyl]carbamate |
| SMILES | C#CCN(Cc1ccc(F)cc1)C(=O)CCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H25FN2O3/c1-5-13-22(14-15-8-10-16(20)11-9-15)17(23)7-6-12-21-18(24)25-19(2,3)4/h1,8-11H,6-7,12-14H2,2-4H3,(H,21,24) |
| InChIKey | VHSCCUMHYKQKJD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|