C19H16F4N2O — CID 56539040
N-[(4-fluorophenyl)methyl]-N-prop-2-ynyl-2-[3-(trifluoromethyl)anilino]acetamide (PubChem CID 56539040) has the molecular formula C19H16F4N2O and a molecular weight of 364.34 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-N-prop-2-ynyl-2-[3-(trifluoromethyl)anilino]acetamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-N-prop-2-ynyl-2-[3-(trifluoromethyl)anilino]acetamide |
|---|---|
| PubChem CID | 56539040 |
| Molecular Formula | C19H16F4N2O |
| Molecular Weight | 364.34 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-N-prop-2-ynyl-2-[3-(trifluoromethyl)anilino]acetamide |
| SMILES | C#CCN(Cc1ccc(F)cc1)C(=O)CNc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H16F4N2O/c1-2-10-25(13-14-6-8-16(20)9-7-14)18(26)12-24-17-5-3-4-15(11-17)19(21,22)23/h1,3-9,11,24H,10,12-13H2 |
| InChIKey | YUQLXMHTHWXKBD-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.34 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|