C15H14F4N2 — CID 54806053
N-(4-fluorophenyl)-N'-[3-(trifluoromethyl)phenyl]ethane-1,2-diamine (PubChem CID 54806053) has the molecular formula C15H14F4N2 and a molecular weight of 298.28 g/mol. Its IUPAC name is N-(4-fluorophenyl)-N'-[3-(trifluoromethyl)phenyl]ethane-1,2-diamine.
| Compound Name | N-(4-fluorophenyl)-N'-[3-(trifluoromethyl)phenyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 54806053 |
| Molecular Formula | C15H14F4N2 |
| Molecular Weight | 298.28 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | N-(4-fluorophenyl)-N'-[3-(trifluoromethyl)phenyl]ethane-1,2-diamine |
| SMILES | Fc1ccc(NCCNc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C15H14F4N2/c16-12-4-6-13(7-5-12)20-8-9-21-14-3-1-2-11(10-14)15(17,18)19/h1-7,10,20-21H,8-9H2 |
| InChIKey | GPTZPUVDKCKFQL-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.28 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|