C11H11F6NO — CID 1477628
(2S)-1,1,1-trifluoro-4-[3-(trifluoromethyl)anilino]butan-2-ol (PubChem CID 1477628) has the molecular formula C11H11F6NO and a molecular weight of 287.20 g/mol. Its IUPAC name is (2S)-1,1,1-trifluoro-4-[3-(trifluoromethyl)anilino]butan-2-ol.
| Compound Name | (2S)-1,1,1-trifluoro-4-[3-(trifluoromethyl)anilino]butan-2-ol |
|---|---|
| PubChem CID | 1477628 |
| Molecular Formula | C11H11F6NO |
| Molecular Weight | 287.20 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | (2S)-1,1,1-trifluoro-4-[3-(trifluoromethyl)anilino]butan-2-ol |
| SMILES | O[C@@H](CCNc1cccc(C(F)(F)F)c1)C(F)(F)F |
| InChI | InChI=1S/C11H11F6NO/c12-10(13,14)7-2-1-3-8(6-7)18-5-4-9(19)11(15,16)17/h1-3,6,9,18-19H,4-5H2/t9-/m0/s1 |
| InChIKey | DIXQZNUQWAYUBA-VIFPVBQESA-N |
| XLogP | 3.43 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.20 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |