C17H19F3N2 — CID 54809449
N'-(2,3-dimethylphenyl)-N-[3-(trifluoromethyl)phenyl]ethane-1,2-diamine (PubChem CID 54809449) has the molecular formula C17H19F3N2 and a molecular weight of 308.35 g/mol. Its IUPAC name is N'-(2,3-dimethylphenyl)-N-[3-(trifluoromethyl)phenyl]ethane-1,2-diamine.
| Compound Name | N'-(2,3-dimethylphenyl)-N-[3-(trifluoromethyl)phenyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 54809449 |
| Molecular Formula | C17H19F3N2 |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | N'-(2,3-dimethylphenyl)-N-[3-(trifluoromethyl)phenyl]ethane-1,2-diamine |
| SMILES | Cc1cccc(NCCNc2cccc(C(F)(F)F)c2)c1C |
| InChI | InChI=1S/C17H19F3N2/c1-12-5-3-8-16(13(12)2)22-10-9-21-15-7-4-6-14(11-15)17(18,19)20/h3-8,11,21-22H,9-10H2,1-2H3 |
| InChIKey | DCEGIWJKCNIZCH-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|