C16H16F3N3S — CID 8625972
1-(2,3-dimethylphenyl)-3-[3-(trifluoromethyl)anilino]thiourea (PubChem CID 8625972) has the molecular formula C16H16F3N3S and a molecular weight of 339.39 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-3-[3-(trifluoromethyl)anilino]thiourea.
| Compound Name | 1-(2,3-dimethylphenyl)-3-[3-(trifluoromethyl)anilino]thiourea |
|---|---|
| PubChem CID | 8625972 |
| Molecular Formula | C16H16F3N3S |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-3-[3-(trifluoromethyl)anilino]thiourea |
| SMILES | Cc1cccc(NC(=S)NNc2cccc(C(F)(F)F)c2)c1C |
| InChI | InChI=1S/C16H16F3N3S/c1-10-5-3-8-14(11(10)2)20-15(23)22-21-13-7-4-6-12(9-13)16(17,18)19/h3-9,21H,1-2H3,(H2,20,22,23) |
| InChIKey | MZWZFUIPSFTFLU-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_urea_D(8)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|