C22H23F3N4S — CID 19344464
1-(2,3-dimethylphenyl)-3-[3,5-dimethyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]thiourea (PubChem CID 19344464) has the molecular formula C22H23F3N4S and a molecular weight of 432.52 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-3-[3,5-dimethyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]thiourea.
| Compound Name | 1-(2,3-dimethylphenyl)-3-[3,5-dimethyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19344464 |
| Molecular Formula | C22H23F3N4S |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-3-[3,5-dimethyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]thiourea |
| SMILES | Cc1cccc(NC(=S)Nc2c(C)nn(Cc3cccc(C(F)(F)F)c3)c2C)c1C |
| InChI | InChI=1S/C22H23F3N4S/c1-13-7-5-10-19(14(13)2)26-21(30)27-20-15(3)28-29(16(20)4)12-17-8-6-9-18(11-17)22(23,24)25/h5-11H,12H2,1-4H3,(H2,26,27,30) |
| InChIKey | QUYPNNGJZCKBPP-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|