C20H18ClF3N4S — CID 19677064
1-[1-[(4-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-[3-(trifluoromethyl)phenyl]thiourea (PubChem CID 19677064) has the molecular formula C20H18ClF3N4S and a molecular weight of 438.91 g/mol. Its IUPAC name is 1-[1-[(4-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-[3-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[1-[(4-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-[3-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 19677064 |
| Molecular Formula | C20H18ClF3N4S |
| Molecular Weight | 438.91 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | 1-[1-[(4-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-[3-(trifluoromethyl)phenyl]thiourea |
| SMILES | Cc1nn(Cc2ccc(Cl)cc2)c(C)c1NC(=S)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H18ClF3N4S/c1-12-18(13(2)28(27-12)11-14-6-8-16(21)9-7-14)26-19(29)25-17-5-3-4-15(10-17)20(22,23)24/h3-10H,11H2,1-2H3,(H2,25,26,29) |
| InChIKey | DBHPTNRARNYHGD-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.91 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|