C19H18F2N4S — CID 19677119
1-(3-fluorophenyl)-3-[1-[(4-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea (PubChem CID 19677119) has the molecular formula C19H18F2N4S and a molecular weight of 372.44 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-3-[1-[(4-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea.
| Compound Name | 1-(3-fluorophenyl)-3-[1-[(4-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19677119 |
| Molecular Formula | C19H18F2N4S |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 1-(3-fluorophenyl)-3-[1-[(4-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea |
| SMILES | Cc1nn(Cc2ccc(F)cc2)c(C)c1NC(=S)Nc1cccc(F)c1 |
| InChI | InChI=1S/C19H18F2N4S/c1-12-18(23-19(26)22-17-5-3-4-16(21)10-17)13(2)25(24-12)11-14-6-8-15(20)9-7-14/h3-10H,11H2,1-2H3,(H2,22,23,26) |
| InChIKey | FHYUMVDOFIBNTM-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|