About 3-bromo-5-fluorobenzoic acid;3-bromo-5-fluoro-N-methoxy-N-methylbenzamide;N-methoxymethanamine
3-bromo-5-fluorobenzoic acid;3-bromo-5-fluoro-N-methoxy-N-methylbenzamide;N-methoxymethanamine (PubChem CID 159093782) has the molecular formula C18H20Br2F2N2O5
and a molecular weight of 542.17 g/mol. Its IUPAC name is 3-bromo-5-fluorobenzoic acid;3-bromo-5-fluoro-N-methoxy-N-methylbenzamide;N-methoxymethanamine.
Molecular Properties
| Compound Name | 3-bromo-5-fluorobenzoic acid;3-bromo-5-fluoro-N-methoxy-N-methylbenzamide;N-methoxymethanamine |
| PubChem CID | 159093782 |
| Molecular Formula | C18H20Br2F2N2O5 |
| Molecular Weight | 542.17 g/mol |
| Exact Mass | 539.97 |
| IUPAC Name | 3-bromo-5-fluorobenzoic acid;3-bromo-5-fluoro-N-methoxy-N-methylbenzamide;N-methoxymethanamine |
| SMILES | CNOC.CON(C)C(=O)c1cc(F)cc(Br)c1.O=C(O)c1cc(F)cc(Br)c1 |
| InChI | InChI=1S/C9H9BrFNO2.C7H4BrFO2.C2H7NO/c1-12(14-2)9(13)6-3-7(10)5-8(11)4-6;8-5-1-4(7(10)11)2-6(9)3-5;1-3-4-2/h3-5H,1-2H3;1-3H,(H,10,11);3H,1-2H3 |
| InChIKey | KCKBCDIQMCQHGG-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 542.17 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-5-fluorobenzoic acid;3-bromo-5-fluoro-N-methoxy-N-methylbenzamide;N-methoxymethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-5-fluorobenzoic acid;3-bromo-5-fluoro-N-methoxy-N-methylbenzamide;N-methoxymethanamine?
The IUPAC name of 3-bromo-5-fluorobenzoic acid;3-bromo-5-fluoro-N-methoxy-N-methylbenzamide;N-methoxymethanamine (CID 159093782) is 3-bromo-5-fluorobenzoic acid;3-bromo-5-fluoro-N-methoxy-N-methylbenzamide;N-methoxymethanamine.
What is the SMILES notation for 3-bromo-5-fluorobenzoic acid;3-bromo-5-fluoro-N-methoxy-N-methylbenzamide;N-methoxymethanamine?
The canonical SMILES for 3-bromo-5-fluorobenzoic acid;3-bromo-5-fluoro-N-methoxy-N-methylbenzamide;N-methoxymethanamine is CNOC.CON(C)C(=O)c1cc(F)cc(Br)c1.O=C(O)c1cc(F)cc(Br)c1.
What is the InChIKey of 3-bromo-5-fluorobenzoic acid;3-bromo-5-fluoro-N-methoxy-N-methylbenzamide;N-methoxymethanamine?
The InChIKey is KCKBCDIQMCQHGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrFNO2.C7H4BrFO2.C2H7NO/c1-12(14-2)9(13)6-3-7(10)5-8(11)4-6;8-5-1-4(7(10)11)2-6(9)3-5;1-3-4-2/h3-5H,1-2H3;1-3H,(H,10,11);3H,1-2H3.
What are the key properties of 3-bromo-5-fluorobenzoic acid;3-bromo-5-fluoro-N-methoxy-N-methylbenzamide;N-methoxymethanamine?
3-bromo-5-fluorobenzoic acid;3-bromo-5-fluoro-N-methoxy-N-methylbenzamide;N-methoxymethanamine has a molecular weight of 542.17 g/mol, XLogP of 4.28, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-5-fluorobenzoic acid;3-bromo-5-fluoro-N-methoxy-N-methylbenzamide;N-methoxymethanamine is sourced from PubChem (CID 159093782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).