C11H15F3N2O3 — CID 158345868
N-methoxymethanamine;2,4,5-trifluoro-N-methoxy-N-methylbenzamide (PubChem CID 158345868) has the molecular formula C11H15F3N2O3 and a molecular weight of 280.25 g/mol. Its IUPAC name is N-methoxymethanamine;2,4,5-trifluoro-N-methoxy-N-methylbenzamide.
| Compound Name | N-methoxymethanamine;2,4,5-trifluoro-N-methoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 158345868 |
| Molecular Formula | C11H15F3N2O3 |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | N-methoxymethanamine;2,4,5-trifluoro-N-methoxy-N-methylbenzamide |
| SMILES | CNOC.CON(C)C(=O)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C9H8F3NO2.C2H7NO/c1-13(15-2)9(14)5-3-7(11)8(12)4-6(5)10;1-3-4-2/h3-4H,1-2H3;3H,1-2H3 |
| InChIKey | GRSNQIZMKMHBHN-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|