About 5-fluoro-N-methoxy-N,2,4-trimethylbenzamide
5-fluoro-N-methoxy-N,2,4-trimethylbenzamide (PubChem CID 89047148) has the molecular formula C11H14FNO2
and a molecular weight of 211.24 g/mol. Its IUPAC name is 5-fluoro-N-methoxy-N,2,4-trimethylbenzamide.
Molecular Properties
| Compound Name | 5-fluoro-N-methoxy-N,2,4-trimethylbenzamide |
| PubChem CID | 89047148 |
| Molecular Formula | C11H14FNO2 |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 5-fluoro-N-methoxy-N,2,4-trimethylbenzamide |
| SMILES | CON(C)C(=O)c1cc(F)c(C)cc1C |
| InChI | InChI=1S/C11H14FNO2/c1-7-5-8(2)10(12)6-9(7)11(14)13(3)15-4/h5-6H,1-4H3 |
| InChIKey | ORNJRFZYUKXNEQ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-N-methoxy-N,2,4-trimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-N-methoxy-N,2,4-trimethylbenzamide?
The IUPAC name of 5-fluoro-N-methoxy-N,2,4-trimethylbenzamide (CID 89047148) is 5-fluoro-N-methoxy-N,2,4-trimethylbenzamide.
What is the SMILES notation for 5-fluoro-N-methoxy-N,2,4-trimethylbenzamide?
The canonical SMILES for 5-fluoro-N-methoxy-N,2,4-trimethylbenzamide is CON(C)C(=O)c1cc(F)c(C)cc1C.
What is the InChIKey of 5-fluoro-N-methoxy-N,2,4-trimethylbenzamide?
The InChIKey is ORNJRFZYUKXNEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14FNO2/c1-7-5-8(2)10(12)6-9(7)11(14)13(3)15-4/h5-6H,1-4H3.
What are the key properties of 5-fluoro-N-methoxy-N,2,4-trimethylbenzamide?
5-fluoro-N-methoxy-N,2,4-trimethylbenzamide has a molecular weight of 211.24 g/mol, XLogP of 2.08, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-N-methoxy-N,2,4-trimethylbenzamide is sourced from PubChem (CID 89047148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).